* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1H-PYRAZOLO[1,5-B][1,2,4]TRIAZOL-6-AMINE, 2-(1-METHYLETHYL)- |
| CAS: | 197355-64-9 |
| English Synonyms: | 2-(1-METHYLETHYL)-1H-PYRAZOLO[1,5-B][1,2,4]TRIAZOL-6-AMINE ; 1H-PYRAZOLO[1,5-B][1,2,4]TRIAZOL-6-AMINE, 2-(1-METHYLETHYL)- ; 2-(PROPAN-2-YL)-1H-PYRAZOLO[1,5-B][1,2,4]TRIAZOL-6-AMINE |
| MDL Number.: | MFCD18809762 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CC(C)c1[nH]c2cc(nn2n1)N |
| InChi: | InChI=1S/C7H11N5/c1-4(2)7-9-6-3-5(8)10-12(6)11-7/h3-4H,1-2H3,(H2,8,10)(H,9,11) |
| InChiKey: | InChIKey=WBQCXZGYIMOCGX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.