* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-HYDROXY-6-METHYL-4H-PYRAN-4-ONE |
| CAS: | 70254-61-4 |
| English Synonyms: | 2-HYDROXY-6-METHYL-4H-PYRAN-4-ONE |
| MDL Number.: | MFCD18820248 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | Cc1cc(=O)cc(o1)O |
| InChi: | InChI=1S/C6H6O3/c1-4-2-5(7)3-6(8)9-4/h2-3,8H,1H3 |
| InChiKey: | InChIKey=OOKCZXGEYPSNIM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.