* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | (R)-5-FLUORO-1-METHYL-1H-INDENE |
| CAS: | 170941-17-0 |
| English Synonyms: | 1H-INDENE, 5-FLUORO-1-METHYL-, (R)- ; (R)-5-FLUORO-1-METHYL-1H-INDENE |
| MDL Number.: | MFCD18835504 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | C[C@@H]1C=Cc2c1ccc(c2)F |
| InChi: | InChI=1S/C10H9F/c1-7-2-3-8-6-9(11)4-5-10(7)8/h2-7H,1H3/t7-/m1/s1 |
| InChiKey: | InChIKey=ZWDJNGVEZDTETR-SSDOTTSWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.