* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX120294 |
English Synonyms: | WUXIAPPTEC WX120294 |
MDL Number.: | MFCD19442528 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CN1C[C@@H]2C[C@](C1)(CN(C2)Cc3ccccc3)C(=O)O |
InChi: | InChI=1S/C16H22N2O2/c1-17-8-14-7-16(11-17,15(19)20)12-18(10-14)9-13-5-3-2-4-6-13/h2-6,14H,7-12H2,1H3,(H,19,20)/t14-,16-/m0/s1 |
InChiKey: | InChIKey=QAIOQDIMEDQSDD-HOCLYGCPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.