* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BORNYLENE |
| CAS: | 464-17-5 |
| English Synonyms: | BORNYLENE |
| MDL Number.: | MFCD19705231 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | CC1([C@@H]2CC[C@]1(C=C2)C)C |
| InChi: | InChI=1S/C10H16/c1-9(2)8-4-6-10(9,3)7-5-8/h4,6,8H,5,7H2,1-3H3/t8-,10+/m0/s1 |
| InChiKey: | InChIKey=KUKRLSJNTMLPPK-WCBMZHEXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.