* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | GW-6604 |
CAS: | 452342-37-9 |
English Synonyms: | 2-PHENYL-4-(3-(PYRIDIN-2-YL)-1H-PYRAZOL-4-YL)PYRIDINE ; GW-6604 |
MDL Number.: | MFCD20528050 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)c2cc(ccn2)c3c[nH]nc3c4ccccn4 |
InChi: | InChI=1S/C19H14N4/c1-2-6-14(7-3-1)18-12-15(9-11-21-18)16-13-22-23-19(16)17-8-4-5-10-20-17/h1-13H,(H,22,23) |
InChiKey: | InChIKey=BDCBRQYHYNUWAM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.