* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL WUXINP01341 |
English Synonyms: | WUXI-NATURAL WUXINP01341 |
MDL Number.: | MFCD21333510 |
H bond acceptor: | 7 |
H bond donor: | 6 |
Smile: | CC1(CC[C@@]2([C@H](C[C@@]3(C(=C2C1)CC[C@H]4[C@]3(CCC5[C@@]4(C[C@@H]([C@@H](C5(CO)CO)O)O)C)C)C)O)C(=O)O)C |
InChi: | InChI=1S/C30H48O7/c1-25(2)10-11-30(24(36)37)18(12-25)17-6-7-20-26(3)13-19(33)23(35)29(15-31,16-32)21(26)8-9-27(20,4)28(17,5)14-22(30)34/h19-23,31-35H,6-16H2,1-5H3,(H,36,37)/t19-,20+,21?,22-,23-,26+,27+,28+,30+/m0/s1 |
InChiKey: | InChIKey=OQMAYMHCJDOLIQ-CQOJXJJWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.