* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL WUXINP01639 |
English Synonyms: | WUXI-NATURAL WUXINP01639 |
MDL Number.: | MFCD21333575 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CC(C)c1cc2c(c(c1O)O)C3(CCCC(C3=CC2=O)(C)C)C |
InChi: | InChI=1S/C20H26O3/c1-11(2)12-9-13-14(21)10-15-19(3,4)7-6-8-20(15,5)16(13)18(23)17(12)22/h9-11,22-23H,6-8H2,1-5H3 |
InChiKey: | InChIKey=NPADGWOASIJKSB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.