* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL WUXINP01655 |
English Synonyms: | WUXI-NATURAL WUXINP01655 |
MDL Number.: | MFCD21333694 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cc1cc2c(cc(c1=O)O)C3(CCCC(C3CC2)(C)C)C=O |
InChi: | InChI=1S/C19H24O3/c1-12-9-13-5-6-16-18(2,3)7-4-8-19(16,11-20)14(13)10-15(21)17(12)22/h9-11,16H,4-8H2,1-3H3,(H,21,22) |
InChiKey: | InChIKey=AHPTYYNWQADPRT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.