* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL WUXINP01783 |
English Synonyms: | WUXI-NATURAL WUXINP01783 |
MDL Number.: | MFCD21333769 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | C[C@H](Cc1ccc(c(c1)OC)O)[C@@H](C)Cc2ccc(c(c2)OC)O |
InChi: | InChI=1S/C20H26O4/c1-13(9-15-5-7-17(21)19(11-15)23-3)14(2)10-16-6-8-18(22)20(12-16)24-4/h5-8,11-14,21-22H,9-10H2,1-4H3/t13-,14+ |
InChiKey: | InChIKey=ADFOLUXMYYCTRR-OKILXGFUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.