* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 101_Y01A050 |
English Synonyms: | WUXI-NATURAL 101_Y01A050 |
MDL Number.: | MFCD21333825 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(CC(C(=O)C5(C)C)C(=O)NCCC(C)(C)C)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C38H61NO4/c1-32(2,3)20-21-39-30(41)24-22-35(8)27(34(6,7)29(24)40)14-15-37(10)28(35)13-12-25-26-23-33(4,5)16-18-38(26,31(42)43-11)19-17-36(25,37)9/h12,24,26-28H,13-23H2,1-11H3,(H,39,41)/t24?,26?,27?,28?,35-,36+,37+,38-/m0/s1 |
InChiKey: | InChIKey=HDOPMJXNALWBOQ-SNEHUADTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.