* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 101_Y01A069 |
English Synonyms: | WUXI-NATURAL 101_Y01A069 |
MDL Number.: | MFCD21333844 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCCCCNC(=O)C1C[C@]2(C(CC[C@@]3(C2CC=C4[C@]3(CC[C@@]5(C4CC(CC5)(C)C)C(=O)OC)C)C)C(C1=O)(C)C)C |
InChi: | InChI=1S/C37H59NO4/c1-10-11-12-21-38-30(40)24-22-34(6)27(33(4,5)29(24)39)15-16-36(8)28(34)14-13-25-26-23-32(2,3)17-19-37(26,31(41)42-9)20-18-35(25,36)7/h13,24,26-28H,10-12,14-23H2,1-9H3,(H,38,40)/t24?,26?,27?,28?,34-,35+,36+,37-/m0/s1 |
InChiKey: | InChIKey=AFBADCOEZOWASP-CXTUKRMXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.