* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 102_Y01A035 |
English Synonyms: | WUXI-NATURAL 102_Y01A035 |
MDL Number.: | MFCD21333906 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(Cc6c(nc([nH]6)Cc7ccc(c(c7)Cl)Cl)C5(C)C)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C39H52Cl2N2O2/c1-34(2)15-17-39(33(44)45-8)18-16-37(6)24(25(39)21-34)10-12-30-36(5)22-28-32(35(3,4)29(36)13-14-38(30,37)7)43-31(42-28)20-23-9-11-26(40)27(41)19-23/h9-11,19,25,29-30H,12-18,20-22H2,1-8H3,(H,42,43)/t25?,29?,30?,36-,37+,38+,39-/m0/s1 |
InChiKey: | InChIKey=RXFQTXGPSRQMGJ-PODFXNNFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.