* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 102_Y01A045 |
English Synonyms: | WUXI-NATURAL 102_Y01A045 |
MDL Number.: | MFCD21333916 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(Cc6c(nc([nH]6)c7cccc(c7)OC)C5(C)C)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C39H54N2O3/c1-34(2)17-19-39(33(42)44-9)20-18-37(6)26(27(39)22-34)13-14-30-36(5)23-28-31(35(3,4)29(36)15-16-38(30,37)7)41-32(40-28)24-11-10-12-25(21-24)43-8/h10-13,21,27,29-30H,14-20,22-23H2,1-9H3,(H,40,41)/t27?,29?,30?,36-,37+,38+,39-/m0/s1 |
InChiKey: | InChIKey=ZECILPKQQXEUAT-JQVAVUSUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.