* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 102_Y01A052 |
English Synonyms: | WUXI-NATURAL 102_Y01A052 |
MDL Number.: | MFCD21333923 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(Cc6c(nc([nH]6)Cc7ccsc7)C5(C)C)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C37H52N2O2S/c1-32(2)14-16-37(31(40)41-8)17-15-35(6)24(25(37)20-32)9-10-28-34(5)21-26-30(33(3,4)27(34)11-13-36(28,35)7)39-29(38-26)19-23-12-18-42-22-23/h9,12,18,22,25,27-28H,10-11,13-17,19-21H2,1-8H3,(H,38,39)/t25?,27?,28?,34-,35+,36+,37-/m0/s1 |
InChiKey: | InChIKey=FZDFSPHJHAQFBU-YSTHOPRPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.