* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y01A036 |
English Synonyms: | WUXI-NATURAL 103_Y01A036 |
MDL Number.: | MFCD21333979 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | Cc1cnc(cn1)C(=O)N2CCN[C@@H]3[C@H]2C[C@]4(C(C3(C)C)CC[C@@]5(C4CC=C6[C@]5(CC[C@@]7(C6CC(CC7)(C)C)C(=O)OC)C)C)C |
InChi: | InChI=1S/C39H58N4O3/c1-24-22-42-27(23-41-24)32(44)43-19-18-40-31-28(43)21-36(6)29(35(31,4)5)12-13-38(8)30(36)11-10-25-26-20-34(2,3)14-16-39(26,33(45)46-9)17-15-37(25,38)7/h10,22-23,26,28-31,40H,11-21H2,1-9H3/t26?,28-,29?,30?,31-,36+,37-,38-,39+/m1/s1 |
InChiKey: | InChIKey=ZDTBNYKTPARUIG-WDGCEJSXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.