* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y01A042 |
English Synonyms: | WUXI-NATURAL 103_Y01A042 |
MDL Number.: | MFCD21333985 |
H bond acceptor: | 8 |
H bond donor: | 1 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@@H]6[C@H](C5(C)C)NCCN6S(=O)(=O)c7cn(cn7)C)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C37H58N4O4S/c1-32(2)14-16-37(31(42)45-9)17-15-35(6)24(25(37)20-32)10-11-28-34(5)21-26-30(33(3,4)27(34)12-13-36(28,35)7)38-18-19-41(26)46(43,44)29-22-40(8)23-39-29/h10,22-23,25-28,30,38H,11-21H2,1-9H3/t25?,26-,27?,28?,30-,34+,35-,36-,37+/m1/s1 |
InChiKey: | InChIKey=RSFQAQJEOFMKPO-KOIYQHFOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.