* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y01A069 |
English Synonyms: | WUXI-NATURAL 103_Y01A069 |
MDL Number.: | MFCD21334012 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@@H]6[C@H](C5(C)C)NCCN6C(=O)Cc7ccc(cc7)F)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C41H59FN2O3/c1-36(2)17-19-41(35(46)47-8)20-18-39(6)28(29(41)24-36)13-14-32-38(5)25-30-34(37(3,4)31(38)15-16-40(32,39)7)43-21-22-44(30)33(45)23-26-9-11-27(42)12-10-26/h9-13,29-32,34,43H,14-25H2,1-8H3/t29?,30-,31?,32?,34-,38+,39-,40-,41+/m1/s1 |
InChiKey: | InChIKey=DWGBGOYCKIWDIB-MOOOVFQBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.