* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y02A056 |
English Synonyms: | WUXI-NATURAL 103_Y02A056 |
MDL Number.: | MFCD21334104 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | Cc1ccccc1C(=O)N2CCN([C@@H]3[C@H]2C[C@]4(C(C3(C)C)CC[C@@]5(C4CC=C6[C@]5(CC[C@@]7(C6CC(CC7)(C)C)C(=O)OC)C)C)C)C |
InChi: | InChI=1S/C42H62N2O3/c1-27-13-11-12-14-28(27)35(45)44-24-23-43(9)34-31(44)26-39(6)32(38(34,4)5)17-18-41(8)33(39)16-15-29-30-25-37(2,3)19-21-42(30,36(46)47-10)22-20-40(29,41)7/h11-15,30-34H,16-26H2,1-10H3/t30?,31-,32?,33?,34-,39+,40-,41-,42+/m1/s1 |
InChiKey: | InChIKey=GVVYKXNJSIAEDO-RAEQMLPBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.