* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GIBBERELLIN A13 |
| CAS: | 2922-24-9 |
| English Synonyms: | GIBBERELLIN A13 |
| MDL Number.: | MFCD00274422 |
| H bond acceptor: | 8 |
| H bond donor: | 5 |
| Smile: | C=C1C[C@]23C[C@@H]1CC[C@H]2[C@@]4(CC[C@@H]([C@@]([C@H]4[C@@H]3C(=O)O)(C(=O)O)O)O)C(=O)O |
| InChi: | InChI=1S/C19H24O8/c1-8-6-17-7-9(8)2-3-10(17)18(15(23)24)5-4-11(20)19(27,16(25)26)13(18)12(17)14(21)22/h9-13,20,27H,1-7H2,(H,21,22)(H,23,24)(H,25,26)/t9-,10+,11-,12+,13-,17-,18+,19+/m0/s1 |
| InChiKey: | InChIKey=YPNPVGJPOAETJE-RSLWUZBCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.