* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2,3,4-TRIMETHYLQUINOLINE |
CAS: | 2437-72-1 ;51366-52-0 |
English Synonyms: | 2,3,4-TRIMETHYLQUINOLINE |
MDL Number.: | MFCD09240593 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | Cc1c(c2ccccc2nc1C)C |
InChi: | InChI=1S/C12H13N/c1-8-9(2)11-6-4-5-7-12(11)13-10(8)3/h4-7H,1-3H3 |
InChiKey: | InChIKey=VBCFHWSPNHEYGE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.