* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-Amino-4,5-dibromophenol |
CAS: | 1037298-16-0 |
English Synonyms: | 2-AMINO-4,5-DIBROMOPHENOL |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | NC1=C(C=C(C(=C1)Br)Br)O |
InChi: | InChI=1S/C6H5Br2NO/c7-3-1-5(9)6(10)2-4(3)8/h1-2,10H,9H2 |
InChiKey: | InChIKey=FLJGRKJRMHAKMV-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.