* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | L-Tyrosine, 2,3,5,6-tetrafluoro- |
CAS: | 157807-84-6 |
English Synonyms: | L-TYROSINE, 2,3,5,6-TETRAFLUORO- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | FC1=C(C[C@H](N)C(=O)O)C(=C(C(=C1F)O)F)F |
InChi: | InChI=1S/C9H7F4NO3/c10-4-2(1-3(14)9(16)17)5(11)7(13)8(15)6(4)12/h3,15H,1,14H2,(H,16,17)/t3-/m0/s1 |
InChiKey: | InChIKey=KFUSMUNGVKVABM-VKHMYHEASA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.