* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | N,N-Dimethyl-4-pentyn-1-amine |
CAS: | 41006-87-5 |
English Synonyms: | N,N-DIMETHYL-4-PENTYN-1-AMINE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CN(CCCC#C)C |
InChi: | InChI=1S/C7H13N/c1-4-5-6-7-8(2)3/h1H,5-7H2,2-3H3 |
InChiKey: | InChIKey=IXRYRPFJSYUEDD-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.