* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | L-Alanine, 3-[(6-acetyl-2-naphthalenyl)amino]- |
CAS: | 1313516-26-5 |
English Synonyms: | L-ALANINE, 3-[(6-ACETYL-2-NAPHTHALENYL)AMINO]- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(C)(=O)C=1C=C2C=CC(=CC2=CC1)NC[C@H](N)C(=O)O |
InChi: | InChI=1S/C15H16N2O3/c1-9(18)10-2-3-12-7-13(5-4-11(12)6-10)17-8-14(16)15(19)20/h2-7,14,17H,8,16H2,1H3,(H,19,20)/t14-/m0/s1 |
InChiKey: | InChIKey=XKZCXMNMUMGDJG-AWEZNQCLSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.