* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Benzene, 1-[(6-bromohexyl)oxy]-4-(1-methylethoxy)- |
CAS: | 91945-10-7 |
English Synonyms: | BENZENE, 1-[(6-BROMOHEXYL)OXY]-4-(1-METHYLETHOXY)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | BrCCCCCCOC1=CC=C(C=C1)OC(C)C |
InChi: | InChI=1S/C15H23BrO2/c1-13(2)18-15-9-7-14(8-10-15)17-12-6-4-3-5-11-16/h7-10,13H,3-6,11-12H2,1-2H3 |
InChiKey: | InChIKey=LFAIHDOGSCWLSM-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.