* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | N-Fmoc-(R)-1-mercapto-2-propanamine |
| CAS: | 202751-94-8 |
| English Synonyms: | N-FMOC-(R)-1-MERCAPTO-2-PROPANAMINE |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | C(=O)(OCC1C2=CC=CC=C2C2=CC=CC=C12)N[C@@H](CS)C |
| InChi: | InChI=1S/C18H19NO2S/c1-12(11-22)19-18(20)21-10-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-9,12,17,22H,10-11H2,1H3,(H,19,20)/t12-/m1/s1 |
| InChiKey: | InChIKey=VHHOQQMSKOYFQF-GFCCVEGCSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.