* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-Hexanone, 6-amino- |
CAS: | 1369170-48-8 |
English Synonyms: | 3-HEXANONE, 6-AMINO- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | NCCCC(CC)=O |
InChi: | InChI=1S/C6H13NO/c1-2-6(8)4-3-5-7/h2-5,7H2,1H3 |
InChiKey: | InChIKey=OFKVVBLDZJUBBW-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.