* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-PROPEN-1-ONE, 3-(DIETHYLAMINO)-3-PHENYL-1-(5-PHENYL-1,2,3-TRIAZOL-4-YL)- |
CAS: | 51720-08-2 |
English Synonyms: | 2-PROPEN-1-ONE, 3-(DIETHYLAMINO)-3-PHENYL-1-(5-PHENYL-1,2,3-TRIAZOL-4-YL)- |
MDL Number.: | MFCD17010121 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCN(CC)/C(=C\C(=O)c1c([nH]nn1)c2ccccc2)/c3ccccc3 |
InChi: | InChI=1S/C21H22N4O/c1-3-25(4-2)18(16-11-7-5-8-12-16)15-19(26)21-20(22-24-23-21)17-13-9-6-10-14-17/h5-15H,3-4H2,1-2H3,(H,22,23,24)/b18-15- |
InChiKey: | InChIKey=PSCGRSCGPZYZJW-SDXDJHTJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.