2-CHLORO-3-CYCLOPROPOXY-5-FLUOROPYRIDINE

pro_cas
pro_cdbregno
CCD03278771
pro_formula
C8 H7 Cl F N O
pro_molWeight
187.6

basic_info

Product_Name: 2-CHLORO-3-CYCLOPROPOXY-5-FLUOROPYRIDINE
EnglishSynonyms: 2-CHLORO-3-CYCLOPROPOXY-5-FLUOROPYRIDINE
pro_mdlNumber: MFCD17007060
pro_acceptors: 2
pro_donors: 0
pro_smile: c1c(cnc(c1OC2CC2)Cl)F
InChi: InChI=1S/C8H7ClFNO/c9-8-7(12-6-1-2-6)3-5(10)4-11-8/h3-4,6H,1-2H2
InChiKey: InChIKey=MWXNQJOPLKBWRU-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.