* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | L-HYDROXYLYSINE |
| CAS: | 172213-74-0 |
| English Synonyms: | L-HYDROXYLYSINE |
| MDL Number.: | MFCD17012635 |
| H bond acceptor: | 5 |
| H bond donor: | 4 |
| Smile: | C(C[C@@H](C(=O)O)N)[C@@H](CN)O |
| InChi: | InChI=1S/C6H14N2O3/c7-3-4(9)1-2-5(8)6(10)11/h4-5,9H,1-3,7-8H2,(H,10,11)/t4-,5-/m0/s1 |
| InChiKey: | InChIKey=YSMODUONRAFBET-WHFBIAKZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.