* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | JTV-519 |
CAS: | 1038410-88-6 ;145903-06-6 |
English Synonyms: | 3-(4-BENZYLPIPERIDIN-1-YL)-1-(7-METHOXY-2,3,4,5-TETRAHYDRO-1,4-BENZOTHIAZEPIN-4-YL)PROPAN-1-ONE ; K-201 ; JTV-519 |
MDL Number.: | MFCD00935784 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | COc1ccc2c(c1)CN(CCS2)C(=O)CCN3CCC(CC3)Cc4ccccc4 |
InChi: | InChI=1S/C25H32N2O2S/c1-29-23-7-8-24-22(18-23)19-27(15-16-30-24)25(28)11-14-26-12-9-21(10-13-26)17-20-5-3-2-4-6-20/h2-8,18,21H,9-17,19H2,1H3 |
InChiKey: | InChIKey=KCWGETCFOVJEPI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.