* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | JTV-519 |
| CAS: | 145903-06-6 ;1038410-88-6 |
| English Synonyms: | 3-(4-BENZYLPIPERIDIN-1-YL)-1-(7-METHOXY-2,3,4,5-TETRAHYDRO-1,4-BENZOTHIAZEPIN-4-YL)PROPAN-1-ONE ; JTV-519 ; K-201 |
| MDL Number.: | MFCD00935784 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | COc1ccc2c(c1)CN(CCS2)C(=O)CCN3CCC(CC3)Cc4ccccc4 |
| InChi: | InChI=1S/C25H32N2O2S/c1-29-23-7-8-24-22(18-23)19-27(15-16-30-24)25(28)11-14-26-12-9-21(10-13-26)17-20-5-3-2-4-6-20/h2-8,18,21H,9-17,19H2,1H3 |
| InChiKey: | InChIKey=KCWGETCFOVJEPI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.