* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FS 205-397 |
CAS: | 116861-51-9 |
English Synonyms: | FS 205-397 |
MDL Number.: | MFCD00877798 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCOc1ccc2c(c1)NCC2(C)C.CS(=O)(=O)O |
InChi: | InChI=1S/C12H17NO.CH4O3S/c1-4-14-9-5-6-10-11(7-9)13-8-12(10,2)3;1-5(2,3)4/h5-7,13H,4,8H2,1-3H3;1H3,(H,2,3,4) |
InChiKey: | InChIKey=QZTLHRAONHZQNK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.