Molecular Structure:
CCD No.:CCD00178729
FS 205-397
CAS No.:
116861-51-9
Formula:C12 H17 N O . C H4 O3 S
MolWeight:287.378
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | FS 205-397 |
| CAS： | 116861-51-9 |
| English Synonyms： | FS 205-397 |
| MDL Number.： | MFCD00877798 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | CCOc1ccc2c(c1)NCC2(C)C.CS(=O)(=O)O |
| InChi： | InChI=1S/C12H17NO.CH4O3S/c1-4-14-9-5-6-10-11(7-9)13-8-12(10,2)3;1-5(2,3)4/h5-7,13H,4,8H2,1-3H3;1H3,(H,2,3,4) |
| InChiKey： | InChIKey=QZTLHRAONHZQNK-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
