Molecular Structure:
CAS No.:
1193266-37-3
Product Name.:
CCD No.:CCD03281801
Formula:C7 H5 Cl N2 O
MolWeight:168.583
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | INDAZOLE, 6-CHLORO-1-HYDROXY- |
| CAS： | 1193266-37-3 |
| English Synonyms： | INDAZOLE, 6-CHLORO-1-HYDROXY- |
| MDL Number.： | MFCD17010090 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | c1cc2cnn(c2cc1Cl)O |
| InChi： | InChI=1S/C7H5ClN2O/c8-6-2-1-5-4-9-10(11)7(5)3-6/h1-4,11H |
| InChiKey： | InChIKey=LRHRLAYEENECFT-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
