Molecular Structure:
CAS No.:
196708-30-2
Product Name.:
CCD No.:CCD02711271
Formula:C6 H3 Cl N2 O2
MolWeight:170.555
![6-CHLORO-ISOXAZOLO[5,4-B]PYRIDIN-3(2H)-ONE Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(2)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | 6-CHLORO-ISOXAZOLO[5,4-B]PYRIDIN-3(2H)-ONE |
| CAS： | 196708-30-2 |
| English Synonyms： | ISOXAZOLO[5,4-B]PYRIDIN-3(2H)-ONE, 6-CHLORO- ; 6-CHLORO-ISOXAZOLO[5,4-B]PYRIDIN-3(2H)-ONE |
| MDL Number.： | MFCD16250018 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | c1cc(nc2c1c(=O)[nH]o2)Cl |
| InChi： | InChI=1S/C6H3ClN2O2/c7-4-2-1-3-5(10)9-11-6(3)8-4/h1-2H,(H,9,10) |
| InChiKey： | InChIKey=HFCLXOMLSRFWMM-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
