* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-CHLORO-ISOXAZOLO[5,4-B]PYRIDIN-3(2H)-ONE |
| CAS: | 196708-30-2 |
| English Synonyms: | ISOXAZOLO[5,4-B]PYRIDIN-3(2H)-ONE, 6-CHLORO- ; 6-CHLORO-ISOXAZOLO[5,4-B]PYRIDIN-3(2H)-ONE |
| MDL Number.: | MFCD16250018 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1cc(nc2c1c(=O)[nH]o2)Cl |
| InChi: | InChI=1S/C6H3ClN2O2/c7-4-2-1-3-5(10)9-11-6(3)8-4/h1-2H,(H,9,10) |
| InChiKey: | InChIKey=HFCLXOMLSRFWMM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.