* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FENABUTENE |
| CAS: | 5984-83-8 |
| English Synonyms: | FENABUTENE |
| MDL Number.: | MFCD00868824 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | C/C=C(\C)/c1ccc(cc1)OC(=O)C |
| InChi: | InChI=1S/C12H14O2/c1-4-9(2)11-5-7-12(8-6-11)14-10(3)13/h4-8H,1-3H3/b9-4+ |
| InChiKey: | InChIKey=SALPXBRLSNRTNE-RUDMXATFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.