* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-METHYLDECANE |
CAS: | 6975-98-0 |
English Synonyms: | 2-METHYLDECANE |
MDL Number.: | MFCD00039994 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CCCCCCCCC(C)C |
InChi: | InChI=1S/C11H24/c1-4-5-6-7-8-9-10-11(2)3/h11H,4-10H2,1-3H3 |
InChiKey: | InChIKey=CNPVJWYWYZMPDS-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.