* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-METHYLDECANE |
| CAS: | 6975-98-0 |
| English Synonyms: | 2-METHYLDECANE |
| MDL Number.: | MFCD00039994 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | CCCCCCCCC(C)C |
| InChi: | InChI=1S/C11H24/c1-4-5-6-7-8-9-10-11(2)3/h11H,4-10H2,1-3H3 |
| InChiKey: | InChIKey=CNPVJWYWYZMPDS-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.