Molecular Structure:
CAS No.:
72636-02-3
Product Name.:
CCD No.:CCD00038319
Formula:C9 H18 N2 O4
MolWeight:218.251
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(4)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | VAL-THR |
| CAS： | 72636-02-3 |
| English Synonyms： | VAL-THR |
| MDL Number.： | MFCD00056750 |
| H bond acceptor： | 6 |
| H bond donor： | 4 |
| Smile： | CC(C)[C@@H](C(=O)N[C@@H]([C@@H](C)O)C(=O)O)N |
| InChi： | InChI=1S/C9H18N2O4/c1-4(2)6(10)8(13)11-7(5(3)12)9(14)15/h4-7,12H,10H2,1-3H3,(H,11,13)(H,14,15)/t5-,6+,7+/m1/s1 |
| InChiKey： | InChIKey=GVRKWABULJAONN-VQVTYTSYSA-N |
|
|
|
|
| WGK Germany： | 3 |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
