* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VAL-THR |
CAS: | 72636-02-3 |
English Synonyms: | VAL-THR |
MDL Number.: | MFCD00056750 |
H bond acceptor: | 6 |
H bond donor: | 4 |
Smile: | CC(C)[C@@H](C(=O)N[C@@H]([C@@H](C)O)C(=O)O)N |
InChi: | InChI=1S/C9H18N2O4/c1-4(2)6(10)8(13)11-7(5(3)12)9(14)15/h4-7,12H,10H2,1-3H3,(H,11,13)(H,14,15)/t5-,6+,7+/m1/s1 |
InChiKey: | InChIKey=GVRKWABULJAONN-VQVTYTSYSA-N |
Property |
|
Safety information |
|
WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.