Molecular Structure:
CAS No.:
77898-86-3
Product Name.:
CCD No.:CCD00089716
Formula:C2 H3 I O2
MolWeight:187.933
![IODOACETIC ACID, [2-14C] Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(2)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | IODOACETIC ACID, [2-14C] |
| CAS： | 77898-86-3 |
| English Synonyms： | IODOACETIC ACID, [2-14C] |
| MDL Number.： | MFCD00189831 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | [14CH2](C(=O)O)I |
| InChi： | InChI=1S/C2H3IO2/c3-1-2(4)5/h1H2,(H,4,5)/i1+2 |
| InChiKey： | InChIKey=JDNTWHVOXJZDSN-NJFSPNSNSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
