* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IODOACETIC ACID, [2-14C] |
CAS: | 77898-86-3 |
English Synonyms: | IODOACETIC ACID, [2-14C] |
MDL Number.: | MFCD00189831 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | [14CH2](C(=O)O)I |
InChi: | InChI=1S/C2H3IO2/c3-1-2(4)5/h1H2,(H,4,5)/i1+2 |
InChiKey: | InChIKey=JDNTWHVOXJZDSN-NJFSPNSNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.