* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CP-53631 |
CAS: | 79836-56-9 |
English Synonyms: | CP-53631 |
MDL Number.: | MFCD17215965 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CN[C@@H]1CC[C@H](c2c1cccc2)c3ccc(cc3)Br.Cl |
InChi: | InChI=1S/C17H18BrN.ClH/c1-19-17-11-10-14(12-6-8-13(18)9-7-12)15-4-2-3-5-16(15)17;/h2-9,14,17,19H,10-11H2,1H3;1H/t14-,17+;/m0./s1 |
InChiKey: | InChIKey=FRGRVQZKRCFTHR-SQQLFYIASA-N |
Property |
|
Safety information |
|
WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.