* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AQ BC 9030 |
English Synonyms: | RARECHEM AQ BC 9030 |
MDL Number.: | MFCD00013278 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | C1C2CC(=O)CC1CC(=O)C2 |
InChi: | InChI=1S/C9H12O2/c10-8-2-6-1-7(4-8)5-9(11)3-6/h6-7H,1-5H2 |
InChiKey: | InChIKey=KIKCULSOJJAIEB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.