* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AQ BC 9030 |
| English Synonyms: | RARECHEM AQ BC 9030 |
| MDL Number.: | MFCD00013278 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | C1C2CC(=O)CC1CC(=O)C2 |
| InChi: | InChI=1S/C9H12O2/c10-8-2-6-1-7(4-8)5-9(11)3-6/h6-7H,1-5H2 |
| InChiKey: | InChIKey=KIKCULSOJJAIEB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.