* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | H-GLY-D-TRP-OH |
| CAS: | 50632-89-8 |
| English Synonyms: | H-GLY-D-TRP-OH |
| MDL Number.: | MFCD00065278 |
| H bond acceptor: | 6 |
| H bond donor: | 4 |
| Smile: | c1ccc2c(c1)c(c[nH]2)C[C@H](C(=O)O)NC(=O)CN |
| InChi: | InChI=1S/C13H15N3O3/c14-6-12(17)16-11(13(18)19)5-8-7-15-10-4-2-1-3-9(8)10/h1-4,7,11,15H,5-6,14H2,(H,16,17)(H,18,19)/t11-/m1/s1 |
| InChiKey: | InChIKey=AJHCSUXXECOXOY-LLVKDONJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.