* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2,2'-CARBONYLBIS(3,5-DIOXO-4-METHYL-1,2,4-OXADIAZOLIDINE) |
| CAS: | 115491-90-2 |
| English Synonyms: | 2,2'-CARBONYLBIS(3,5-DIOXO-4-METHYL-1,2,4-OXADIAZOLIDINE) |
| MDL Number.: | MFCD00191328 |
| H bond acceptor: | 11 |
| H bond donor: | 0 |
| Smile: | Cn1c(=O)n(oc1=O)C(=O)n2c(=O)n(c(=O)o2)C |
| InChi: | InChI=1S/C7H6N4O7/c1-8-3(12)10(17-6(8)15)5(14)11-4(13)9(2)7(16)18-11/h1-2H3 |
| InChiKey: | InChIKey=IOMAUIUYBQXXKP-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.